C20H21ClN2OS2 — CID 59072821
2-butyl-N-[(4-chlorophenyl)methyl]-7-methyl-4-sulfanylidenethieno[2,3-b]pyridine-5-carboxamide (PubChem CID 59072821) has the molecular formula C20H21ClN2OS2 and a molecular weight of 404.99 g/mol. Its IUPAC name is 2-butyl-N-[(4-chlorophenyl)methyl]-7-methyl-4-sulfanylidenethieno[2,3-b]pyridine-5-carboxamide.
| Compound Name | 2-butyl-N-[(4-chlorophenyl)methyl]-7-methyl-4-sulfanylidenethieno[2,3-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 59072821 |
| Molecular Formula | C20H21ClN2OS2 |
| Molecular Weight | 404.99 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 2-butyl-N-[(4-chlorophenyl)methyl]-7-methyl-4-sulfanylidenethieno[2,3-b]pyridine-5-carboxamide |
| SMILES | CCCCc1cc2c(=S)c(C(=O)NCc3ccc(Cl)cc3)cn(C)c2s1 |
| InChI | InChI=1S/C20H21ClN2OS2/c1-3-4-5-15-10-16-18(25)17(12-23(2)20(16)26-15)19(24)22-11-13-6-8-14(21)9-7-13/h6-10,12H,3-5,11H2,1-2H3,(H,22,24) |
| InChIKey | GTWSTGMJFWOAMG-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.99 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|