C18H16ClIN2OS2 — CID 10278781
N-[(4-chlorophenyl)methyl]-2-iodo-7-propan-2-yl-4-sulfanylidenethieno[2,3-b]pyridine-5-carboxamide (PubChem CID 10278781) has the molecular formula C18H16ClIN2OS2 and a molecular weight of 502.83 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-iodo-7-propan-2-yl-4-sulfanylidenethieno[2,3-b]pyridine-5-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-iodo-7-propan-2-yl-4-sulfanylidenethieno[2,3-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 10278781 |
| Molecular Formula | C18H16ClIN2OS2 |
| Molecular Weight | 502.83 g/mol |
| Exact Mass | 501.94 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-iodo-7-propan-2-yl-4-sulfanylidenethieno[2,3-b]pyridine-5-carboxamide |
| SMILES | CC(C)n1cc(C(=O)NCc2ccc(Cl)cc2)c(=S)c2cc(I)sc21 |
| InChI | InChI=1S/C18H16ClIN2OS2/c1-10(2)22-9-14(16(24)13-7-15(20)25-18(13)22)17(23)21-8-11-3-5-12(19)6-4-11/h3-7,9-10H,8H2,1-2H3,(H,21,23) |
| InChIKey | JBJDWMDYIZXHJK-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.83 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|