C15H10ClIN2OS2 — CID 10276372
N-[(4-chlorophenyl)methyl]-2-iodo-4-sulfanylidene-7H-thieno[2,3-b]pyridine-5-carboxamide (PubChem CID 10276372) has the molecular formula C15H10ClIN2OS2 and a molecular weight of 460.75 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-iodo-4-sulfanylidene-7H-thieno[2,3-b]pyridine-5-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-iodo-4-sulfanylidene-7H-thieno[2,3-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 10276372 |
| Molecular Formula | C15H10ClIN2OS2 |
| Molecular Weight | 460.75 g/mol |
| Exact Mass | 459.90 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-iodo-4-sulfanylidene-7H-thieno[2,3-b]pyridine-5-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1c[nH]c2sc(I)cc2c1=S |
| InChI | InChI=1S/C15H10ClIN2OS2/c16-9-3-1-8(2-4-9)6-18-14(20)11-7-19-15-10(13(11)21)5-12(17)22-15/h1-5,7H,6H2,(H,18,20)(H,19,21) |
| InChIKey | YWUZQJHZFNFFRG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.75 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|