C12H9Cl2N3O2 — CID 69217820
3-chloro-N-[(4-chlorophenyl)methyl]-6-oxo-1H-pyridazine-5-carboxamide (PubChem CID 69217820) has the molecular formula C12H9Cl2N3O2 and a molecular weight of 298.13 g/mol. Its IUPAC name is 3-chloro-N-[(4-chlorophenyl)methyl]-6-oxo-1H-pyridazine-5-carboxamide.
| Compound Name | 3-chloro-N-[(4-chlorophenyl)methyl]-6-oxo-1H-pyridazine-5-carboxamide |
|---|---|
| PubChem CID | 69217820 |
| Molecular Formula | C12H9Cl2N3O2 |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 3-chloro-N-[(4-chlorophenyl)methyl]-6-oxo-1H-pyridazine-5-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1cc(Cl)n[nH]c1=O |
| InChI | InChI=1S/C12H9Cl2N3O2/c13-8-3-1-7(2-4-8)6-15-11(18)9-5-10(14)16-17-12(9)19/h1-5H,6H2,(H,15,18)(H,17,19) |
| InChIKey | KRIHVCSRNOLUAB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |