C19H14ClN3O4 — CID 59018051
3-[5-[(4-chlorophenyl)methylcarbamoyl]-6-oxo-1H-pyridazin-3-yl]benzoic acid (PubChem CID 59018051) has the molecular formula C19H14ClN3O4 and a molecular weight of 383.79 g/mol. Its IUPAC name is 3-[5-[(4-chlorophenyl)methylcarbamoyl]-6-oxo-1H-pyridazin-3-yl]benzoic acid.
| Compound Name | 3-[5-[(4-chlorophenyl)methylcarbamoyl]-6-oxo-1H-pyridazin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 59018051 |
| Molecular Formula | C19H14ClN3O4 |
| Molecular Weight | 383.79 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 3-[5-[(4-chlorophenyl)methylcarbamoyl]-6-oxo-1H-pyridazin-3-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2cc(C(=O)NCc3ccc(Cl)cc3)c(=O)[nH]n2)c1 |
| InChI | InChI=1S/C19H14ClN3O4/c20-14-6-4-11(5-7-14)10-21-17(24)15-9-16(22-23-18(15)25)12-2-1-3-13(8-12)19(26)27/h1-9H,10H2,(H,21,24)(H,23,25)(H,26,27) |
| InChIKey | LGPUSBBNCSHAPP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.79 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |