C25H19N3O4 — CID 108745418
3-[[(6-oxo-3,4-diphenyl-1H-pyridazine-5-carbonyl)amino]methyl]benzoic acid (PubChem CID 108745418) has the molecular formula C25H19N3O4 and a molecular weight of 425.44 g/mol. Its IUPAC name is 3-[[(6-oxo-3,4-diphenyl-1H-pyridazine-5-carbonyl)amino]methyl]benzoic acid.
| Compound Name | 3-[[(6-oxo-3,4-diphenyl-1H-pyridazine-5-carbonyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 108745418 |
| Molecular Formula | C25H19N3O4 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 3-[[(6-oxo-3,4-diphenyl-1H-pyridazine-5-carbonyl)amino]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CNC(=O)c2c(-c3ccccc3)c(-c3ccccc3)n[nH]c2=O)c1 |
| InChI | InChI=1S/C25H19N3O4/c29-23(26-15-16-8-7-13-19(14-16)25(31)32)21-20(17-9-3-1-4-10-17)22(27-28-24(21)30)18-11-5-2-6-12-18/h1-14H,15H2,(H,26,29)(H,28,30)(H,31,32) |
| InChIKey | DWWBVPFSYNYAMQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |