C25H19N3O4 — CID 108803578
methyl 3-[(6-oxo-3,4-diphenyl-1H-pyridazine-5-carbonyl)amino]benzoate (PubChem CID 108803578) has the molecular formula C25H19N3O4 and a molecular weight of 425.44 g/mol. Its IUPAC name is methyl 3-[(6-oxo-3,4-diphenyl-1H-pyridazine-5-carbonyl)amino]benzoate.
| Compound Name | methyl 3-[(6-oxo-3,4-diphenyl-1H-pyridazine-5-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 108803578 |
| Molecular Formula | C25H19N3O4 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | methyl 3-[(6-oxo-3,4-diphenyl-1H-pyridazine-5-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2c(-c3ccccc3)c(-c3ccccc3)n[nH]c2=O)c1 |
| InChI | InChI=1S/C25H19N3O4/c1-32-25(31)18-13-8-14-19(15-18)26-23(29)21-20(16-9-4-2-5-10-16)22(27-28-24(21)30)17-11-6-3-7-12-17/h2-15H,1H3,(H,26,29)(H,28,30) |
| InChIKey | BVAXJRRCTCDBTC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |