C18H13F3N4O3 — CID 59017983
6-oxo-3-pyridin-4-yl-N-[[3-(trifluoromethoxy)phenyl]methyl]-1H-pyridazine-5-carboxamide (PubChem CID 59017983) has the molecular formula C18H13F3N4O3 and a molecular weight of 390.32 g/mol. Its IUPAC name is 6-oxo-3-pyridin-4-yl-N-[[3-(trifluoromethoxy)phenyl]methyl]-1H-pyridazine-5-carboxamide.
| Compound Name | 6-oxo-3-pyridin-4-yl-N-[[3-(trifluoromethoxy)phenyl]methyl]-1H-pyridazine-5-carboxamide |
|---|---|
| PubChem CID | 59017983 |
| Molecular Formula | C18H13F3N4O3 |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 6-oxo-3-pyridin-4-yl-N-[[3-(trifluoromethoxy)phenyl]methyl]-1H-pyridazine-5-carboxamide |
| SMILES | O=C(NCc1cccc(OC(F)(F)F)c1)c1cc(-c2ccncc2)n[nH]c1=O |
| InChI | InChI=1S/C18H13F3N4O3/c19-18(20,21)28-13-3-1-2-11(8-13)10-23-16(26)14-9-15(24-25-17(14)27)12-4-6-22-7-5-12/h1-9H,10H2,(H,23,26)(H,25,27) |
| InChIKey | DUVOBFBUDGGVIB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |