C23H17F6N3O4 — CID 10142418
2-N,4-N-bis[[3-(trifluoromethoxy)phenyl]methyl]pyridine-2,4-dicarboxamide (PubChem CID 10142418) has the molecular formula C23H17F6N3O4 and a molecular weight of 513.39 g/mol. Its IUPAC name is 2-N,4-N-bis[[3-(trifluoromethoxy)phenyl]methyl]pyridine-2,4-dicarboxamide.
| Compound Name | 2-N,4-N-bis[[3-(trifluoromethoxy)phenyl]methyl]pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 10142418 |
| Molecular Formula | C23H17F6N3O4 |
| Molecular Weight | 513.39 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | 2-N,4-N-bis[[3-(trifluoromethoxy)phenyl]methyl]pyridine-2,4-dicarboxamide |
| SMILES | O=C(NCc1cccc(OC(F)(F)F)c1)c1ccnc(C(=O)NCc2cccc(OC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C23H17F6N3O4/c24-22(25,26)35-17-5-1-3-14(9-17)12-31-20(33)16-7-8-30-19(11-16)21(34)32-13-15-4-2-6-18(10-15)36-23(27,28)29/h1-11H,12-13H2,(H,31,33)(H,32,34) |
| InChIKey | NTLJEBHQNVXPPJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |