C16H13N5O3 — CID 135401020
6-oxo-3-(4-oxo-1H-pyridin-3-yl)-N-(pyridin-4-ylmethyl)-1H-pyridazine-5-carboxamide (PubChem CID 135401020) has the molecular formula C16H13N5O3 and a molecular weight of 323.31 g/mol. Its IUPAC name is 6-oxo-3-(4-oxo-1H-pyridin-3-yl)-N-(pyridin-4-ylmethyl)-1H-pyridazine-5-carboxamide.
| Compound Name | 6-oxo-3-(4-oxo-1H-pyridin-3-yl)-N-(pyridin-4-ylmethyl)-1H-pyridazine-5-carboxamide |
|---|---|
| PubChem CID | 135401020 |
| Molecular Formula | C16H13N5O3 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 6-oxo-3-(4-oxo-1H-pyridin-3-yl)-N-(pyridin-4-ylmethyl)-1H-pyridazine-5-carboxamide |
| SMILES | O=C(NCc1ccncc1)c1cc(-c2c[nH]ccc2=O)n[nH]c1=O |
| InChI | InChI=1S/C16H13N5O3/c22-14-3-6-18-9-12(14)13-7-11(16(24)21-20-13)15(23)19-8-10-1-4-17-5-2-10/h1-7,9H,8H2,(H,18,22)(H,19,23)(H,21,24) |
| InChIKey | OZTMCJSRYQBLCC-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |