C24H25ClN2O5S — CID 18753144
N-[(4-chlorophenyl)methyl]-2,2-bis(hydroxymethyl)-7-(3-hydroxypropyl)-10-sulfanylidene-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraene-11-carboxamide (PubChem CID 18753144) has the molecular formula C24H25ClN2O5S and a molecular weight of 488.99 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2,2-bis(hydroxymethyl)-7-(3-hydroxypropyl)-10-sulfanylidene-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraene-11-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2,2-bis(hydroxymethyl)-7-(3-hydroxypropyl)-10-sulfanylidene-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 18753144 |
| Molecular Formula | C24H25ClN2O5S |
| Molecular Weight | 488.99 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2,2-bis(hydroxymethyl)-7-(3-hydroxypropyl)-10-sulfanylidene-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraene-11-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1cn2c3c(cc(CCCO)cc3c1=S)OCC2(CO)CO |
| InChI | InChI=1S/C24H25ClN2O5S/c25-17-5-3-15(4-6-17)10-26-23(31)19-11-27-21-18(22(19)33)8-16(2-1-7-28)9-20(21)32-14-24(27,12-29)13-30/h3-6,8-9,11,28-30H,1-2,7,10,12-14H2,(H,26,31) |
| InChIKey | UUEZJFAWFZDUGZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.99 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|