C13H14N2O4 — CID 43813799
N-(2-hydroxyethyl)-6-methoxy-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 43813799) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-6-methoxy-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-6-methoxy-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 43813799 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | N-(2-hydroxyethyl)-6-methoxy-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | COc1ccc2[nH]cc(C(=O)NCCO)c(=O)c2c1 |
| InChI | InChI=1S/C13H14N2O4/c1-19-8-2-3-11-9(6-8)12(17)10(7-15-11)13(18)14-4-5-16/h2-3,6-7,16H,4-5H2,1H3,(H,14,18)(H,15,17) |
| InChIKey | UZSHPAHLBZOICP-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |