C11H11N3O3 — CID 95233454
6-methoxy-4-oxo-1H-quinoline-3-carbohydrazide (PubChem CID 95233454) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is 6-methoxy-4-oxo-1H-quinoline-3-carbohydrazide.
| Compound Name | 6-methoxy-4-oxo-1H-quinoline-3-carbohydrazide |
|---|---|
| PubChem CID | 95233454 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 6-methoxy-4-oxo-1H-quinoline-3-carbohydrazide |
| SMILES | COc1ccc2[nH]cc(C(=O)NN)c(=O)c2c1 |
| InChI | InChI=1S/C11H11N3O3/c1-17-6-2-3-9-7(4-6)10(15)8(5-13-9)11(16)14-12/h2-5H,12H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | CHBUWKPUCKIYGS-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|