C17H24N3O3+ — CID 7391278
diethyl-[2-[(6-methoxy-4-oxo-1H-quinoline-3-carbonyl)amino]ethyl]azanium (PubChem CID 7391278) has the molecular formula C17H24N3O3+ and a molecular weight of 318.40 g/mol. Its IUPAC name is diethyl-[2-[(6-methoxy-4-oxo-1H-quinoline-3-carbonyl)amino]ethyl]azanium.
| Compound Name | diethyl-[2-[(6-methoxy-4-oxo-1H-quinoline-3-carbonyl)amino]ethyl]azanium |
|---|---|
| PubChem CID | 7391278 |
| Molecular Formula | C17H24N3O3+ |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | diethyl-[2-[(6-methoxy-4-oxo-1H-quinoline-3-carbonyl)amino]ethyl]azanium |
| SMILES | CC[NH+](CC)CCNC(=O)c1c[nH]c2ccc(OC)cc2c1=O |
| InChI | InChI=1S/C17H23N3O3/c1-4-20(5-2)9-8-18-17(22)14-11-19-15-7-6-12(23-3)10-13(15)16(14)21/h6-7,10-11H,4-5,8-9H2,1-3H3,(H,18,22)(H,19,21)/p+1 |
| InChIKey | GKMZQGNWRRQPBY-UHFFFAOYSA-O |
| XLogP | 0.19 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |