C18H26N3O3+ — CID 7391284
2-[(6-ethoxy-4-oxo-1H-quinoline-3-carbonyl)amino]ethyl-diethylazanium (PubChem CID 7391284) has the molecular formula C18H26N3O3+ and a molecular weight of 332.42 g/mol. Its IUPAC name is 2-[(6-ethoxy-4-oxo-1H-quinoline-3-carbonyl)amino]ethyl-diethylazanium.
| Compound Name | 2-[(6-ethoxy-4-oxo-1H-quinoline-3-carbonyl)amino]ethyl-diethylazanium |
|---|---|
| PubChem CID | 7391284 |
| Molecular Formula | C18H26N3O3+ |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 2-[(6-ethoxy-4-oxo-1H-quinoline-3-carbonyl)amino]ethyl-diethylazanium |
| SMILES | CCOc1ccc2[nH]cc(C(=O)NCC[NH+](CC)CC)c(=O)c2c1 |
| InChI | InChI=1S/C18H25N3O3/c1-4-21(5-2)10-9-19-18(23)15-12-20-16-8-7-13(24-6-3)11-14(16)17(15)22/h7-8,11-12H,4-6,9-10H2,1-3H3,(H,19,23)(H,20,22)/p+1 |
| InChIKey | PCBINKBSWVOKMV-UHFFFAOYSA-O |
| XLogP | 0.58 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |