C22H16ClFN2O4 — CID 18698605
5-[3-[(4-chlorophenyl)methylcarbamoyl]-8-fluoro-4-oxo-1H-quinolin-6-yl]pent-4-ynoic acid (PubChem CID 18698605) has the molecular formula C22H16ClFN2O4 and a molecular weight of 426.83 g/mol. Its IUPAC name is 5-[3-[(4-chlorophenyl)methylcarbamoyl]-8-fluoro-4-oxo-1H-quinolin-6-yl]pent-4-ynoic acid.
| Compound Name | 5-[3-[(4-chlorophenyl)methylcarbamoyl]-8-fluoro-4-oxo-1H-quinolin-6-yl]pent-4-ynoic acid |
|---|---|
| PubChem CID | 18698605 |
| Molecular Formula | C22H16ClFN2O4 |
| Molecular Weight | 426.83 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 5-[3-[(4-chlorophenyl)methylcarbamoyl]-8-fluoro-4-oxo-1H-quinolin-6-yl]pent-4-ynoic acid |
| SMILES | O=C(O)CCC#Cc1cc(F)c2[nH]cc(C(=O)NCc3ccc(Cl)cc3)c(=O)c2c1 |
| InChI | InChI=1S/C22H16ClFN2O4/c23-15-7-5-13(6-8-15)11-26-22(30)17-12-25-20-16(21(17)29)9-14(10-18(20)24)3-1-2-4-19(27)28/h5-10,12H,2,4,11H2,(H,25,29)(H,26,30)(H,27,28) |
| InChIKey | ZGPCPPKKSDTDSP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.83 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|