C18H13ClFIN2O2 — CID 142646908
N-[2-(4-chlorophenyl)ethyl]-8-fluoro-6-iodo-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 142646908) has the molecular formula C18H13ClFIN2O2 and a molecular weight of 470.67 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-8-fluoro-6-iodo-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-8-fluoro-6-iodo-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 142646908 |
| Molecular Formula | C18H13ClFIN2O2 |
| Molecular Weight | 470.67 g/mol |
| Exact Mass | 469.97 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-8-fluoro-6-iodo-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)c1c[nH]c2c(F)cc(I)cc2c1=O |
| InChI | InChI=1S/C18H13ClFIN2O2/c19-11-3-1-10(2-4-11)5-6-22-18(25)14-9-23-16-13(17(14)24)7-12(21)8-15(16)20/h1-4,7-9H,5-6H2,(H,22,25)(H,23,24) |
| InChIKey | PYDCWAZXSZXLEX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.67 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|