C21H21ClFN3O5S2 — CID 18698608
N-[(4-chlorophenyl)methyl]-8-fluoro-6-[2-(2-hydroxyethylsulfanyl)ethylsulfamoyl]-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 18698608) has the molecular formula C21H21ClFN3O5S2 and a molecular weight of 514.00 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-8-fluoro-6-[2-(2-hydroxyethylsulfanyl)ethylsulfamoyl]-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-8-fluoro-6-[2-(2-hydroxyethylsulfanyl)ethylsulfamoyl]-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 18698608 |
| Molecular Formula | C21H21ClFN3O5S2 |
| Molecular Weight | 514.00 g/mol |
| Exact Mass | 513.06 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-8-fluoro-6-[2-(2-hydroxyethylsulfanyl)ethylsulfamoyl]-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1c[nH]c2c(F)cc(S(=O)(=O)NCCSCCO)cc2c1=O |
| InChI | InChI=1S/C21H21ClFN3O5S2/c22-14-3-1-13(2-4-14)11-25-21(29)17-12-24-19-16(20(17)28)9-15(10-18(19)23)33(30,31)26-5-7-32-8-6-27/h1-4,9-10,12,26-27H,5-8,11H2,(H,24,28)(H,25,29) |
| InChIKey | DFGODJXSMBJRRR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.00 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|