C14H10BF4NO3 — CID 59342464
difluoroboranyl 1-cyclopropyl-6,7-difluoro-5-methyl-4-oxoquinoline-3-carboxylate (PubChem CID 59342464) has the molecular formula C14H10BF4NO3 and a molecular weight of 327.04 g/mol. Its IUPAC name is difluoroboranyl 1-cyclopropyl-6,7-difluoro-5-methyl-4-oxoquinoline-3-carboxylate.
| Compound Name | difluoroboranyl 1-cyclopropyl-6,7-difluoro-5-methyl-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 59342464 |
| Molecular Formula | C14H10BF4NO3 |
| Molecular Weight | 327.04 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | difluoroboranyl 1-cyclopropyl-6,7-difluoro-5-methyl-4-oxoquinoline-3-carboxylate |
| SMILES | Cc1c(F)c(F)cc2c1c(=O)c(C(=O)OB(F)F)cn2C1CC1 |
| InChI | InChI=1S/C14H10BF4NO3/c1-6-11-10(4-9(16)12(6)17)20(7-2-3-7)5-8(13(11)21)14(22)23-15(18)19/h4-5,7H,2-3H2,1H3 |
| InChIKey | GOQFZSGPQSYLNA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.04 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|