C14H8BF6NO4 — CID 15282972
difluoroboranyl 1-cyclopropyl-8-(difluoromethoxy)-6,7-difluoro-4-oxoquinoline-3-carboxylate (PubChem CID 15282972) has the molecular formula C14H8BF6NO4 and a molecular weight of 379.02 g/mol. Its IUPAC name is difluoroboranyl 1-cyclopropyl-8-(difluoromethoxy)-6,7-difluoro-4-oxoquinoline-3-carboxylate.
| Compound Name | difluoroboranyl 1-cyclopropyl-8-(difluoromethoxy)-6,7-difluoro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 15282972 |
| Molecular Formula | C14H8BF6NO4 |
| Molecular Weight | 379.02 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | difluoroboranyl 1-cyclopropyl-8-(difluoromethoxy)-6,7-difluoro-4-oxoquinoline-3-carboxylate |
| SMILES | O=C(OB(F)F)c1cn(C2CC2)c2c(OC(F)F)c(F)c(F)cc2c1=O |
| InChI | InChI=1S/C14H8BF6NO4/c16-8-3-6-10(12(9(8)17)25-14(18)19)22(5-1-2-5)4-7(11(6)23)13(24)26-15(20)21/h3-5,14H,1-2H2 |
| InChIKey | GLQQXCHKCFJZOO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.02 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|