C14H9BF5NO4 — CID 12993653
difluoroboranyl 6,7-difluoro-1-[(1R,2S)-2-fluorocyclopropyl]-8-methoxy-4-oxoquinoline-3-carboxylate (PubChem CID 12993653) has the molecular formula C14H9BF5NO4 and a molecular weight of 361.03 g/mol. Its IUPAC name is difluoroboranyl 6,7-difluoro-1-[(1R,2S)-2-fluorocyclopropyl]-8-methoxy-4-oxoquinoline-3-carboxylate.
| Compound Name | difluoroboranyl 6,7-difluoro-1-[(1R,2S)-2-fluorocyclopropyl]-8-methoxy-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 12993653 |
| Molecular Formula | C14H9BF5NO4 |
| Molecular Weight | 361.03 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | difluoroboranyl 6,7-difluoro-1-[(1R,2S)-2-fluorocyclopropyl]-8-methoxy-4-oxoquinoline-3-carboxylate |
| SMILES | COc1c(F)c(F)cc2c(=O)c(C(=O)OB(F)F)cn([C@@H]3C[C@@H]3F)c12 |
| InChI | InChI=1S/C14H9BF5NO4/c1-24-13-10(18)8(17)2-5-11(13)21(9-3-7(9)16)4-6(12(5)22)14(23)25-15(19)20/h2,4,7,9H,3H2,1H3/t7-,9+/m0/s1 |
| InChIKey | OGYDWXGJDJERBV-IONNQARKSA-N |
| XLogP | 2.65 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.03 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|