C13H10BF4NO4 — CID 57131028
difluoroboranyl 1-ethyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylate (PubChem CID 57131028) has the molecular formula C13H10BF4NO4 and a molecular weight of 331.03 g/mol. Its IUPAC name is difluoroboranyl 1-ethyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylate.
| Compound Name | difluoroboranyl 1-ethyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 57131028 |
| Molecular Formula | C13H10BF4NO4 |
| Molecular Weight | 331.03 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | difluoroboranyl 1-ethyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylate |
| SMILES | CCn1cc(C(=O)OB(F)F)c(=O)c2cc(F)c(F)c(OC)c21 |
| InChI | InChI=1S/C13H10BF4NO4/c1-3-19-5-7(13(21)23-14(17)18)11(20)6-4-8(15)9(16)12(22-2)10(6)19/h4-5H,3H2,1-2H3 |
| InChIKey | OUIQGCDOCAALHV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.03 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|