C12H11FN2O4 — CID 90373252
1-ethyl-8-fluoro-6,7-dihydroxy-4-oxoquinoline-3-carboxamide (PubChem CID 90373252) has the molecular formula C12H11FN2O4 and a molecular weight of 266.23 g/mol. Its IUPAC name is 1-ethyl-8-fluoro-6,7-dihydroxy-4-oxoquinoline-3-carboxamide.
| Compound Name | 1-ethyl-8-fluoro-6,7-dihydroxy-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 90373252 |
| Molecular Formula | C12H11FN2O4 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 1-ethyl-8-fluoro-6,7-dihydroxy-4-oxoquinoline-3-carboxamide |
| SMILES | CCn1cc(C(N)=O)c(=O)c2cc(O)c(O)c(F)c21 |
| InChI | InChI=1S/C12H11FN2O4/c1-2-15-4-6(12(14)19)10(17)5-3-7(16)11(18)8(13)9(5)15/h3-4,16,18H,2H2,1H3,(H2,14,19) |
| InChIKey | WIPPWPCLKBZJRO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|