C13H10F2N2O5 — CID 102466718
1-ethyl-6,8-difluoro-7-(nitromethyl)-4-oxoquinoline-3-carboxylic acid (PubChem CID 102466718) has the molecular formula C13H10F2N2O5 and a molecular weight of 312.23 g/mol. Its IUPAC name is 1-ethyl-6,8-difluoro-7-(nitromethyl)-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-ethyl-6,8-difluoro-7-(nitromethyl)-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 102466718 |
| Molecular Formula | C13H10F2N2O5 |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 1-ethyl-6,8-difluoro-7-(nitromethyl)-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(C[N+](=O)[O-])c(F)c21 |
| InChI | InChI=1S/C13H10F2N2O5/c1-2-16-4-8(13(19)20)12(18)6-3-9(14)7(5-17(21)22)10(15)11(6)16/h3-4H,2,5H2,1H3,(H,19,20) |
| InChIKey | VCNRULCSBNYBPE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|