C18H21F3N2O2 — CID 56873052
1-ethyl-6,7,8-trifluoro-N-methyl-4-oxo-N-pentan-3-ylquinoline-3-carboxamide (PubChem CID 56873052) has the molecular formula C18H21F3N2O2 and a molecular weight of 354.37 g/mol. Its IUPAC name is 1-ethyl-6,7,8-trifluoro-N-methyl-4-oxo-N-pentan-3-ylquinoline-3-carboxamide.
| Compound Name | 1-ethyl-6,7,8-trifluoro-N-methyl-4-oxo-N-pentan-3-ylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 56873052 |
| Molecular Formula | C18H21F3N2O2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1-ethyl-6,7,8-trifluoro-N-methyl-4-oxo-N-pentan-3-ylquinoline-3-carboxamide |
| SMILES | CCC(CC)N(C)C(=O)c1cn(CC)c2c(F)c(F)c(F)cc2c1=O |
| InChI | InChI=1S/C18H21F3N2O2/c1-5-10(6-2)22(4)18(25)12-9-23(7-3)16-11(17(12)24)8-13(19)14(20)15(16)21/h8-10H,5-7H2,1-4H3 |
| InChIKey | MZQPYOVKWHVFBV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|