C21H29FN4O2 — CID 166276124
N-butan-2-yl-1-ethyl-6-fluoro-N-methyl-4-oxo-7-piperazin-1-ylquinoline-3-carboxamide (PubChem CID 166276124) has the molecular formula C21H29FN4O2 and a molecular weight of 388.49 g/mol. Its IUPAC name is N-butan-2-yl-1-ethyl-6-fluoro-N-methyl-4-oxo-7-piperazin-1-ylquinoline-3-carboxamide.
| Compound Name | N-butan-2-yl-1-ethyl-6-fluoro-N-methyl-4-oxo-7-piperazin-1-ylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 166276124 |
| Molecular Formula | C21H29FN4O2 |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | N-butan-2-yl-1-ethyl-6-fluoro-N-methyl-4-oxo-7-piperazin-1-ylquinoline-3-carboxamide |
| SMILES | CCC(C)N(C)C(=O)c1cn(CC)c2cc(N3CCNCC3)c(F)cc2c1=O |
| InChI | InChI=1S/C21H29FN4O2/c1-5-14(3)24(4)21(28)16-13-25(6-2)18-12-19(26-9-7-23-8-10-26)17(22)11-15(18)20(16)27/h11-14,23H,5-10H2,1-4H3 |
| InChIKey | IRBMMYZCKADLPS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |