C19H24FN3O4 — CID 144699505
ethane;2-(1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinolin-3-yl)-2-oxoacetic acid (PubChem CID 144699505) has the molecular formula C19H24FN3O4 and a molecular weight of 377.42 g/mol. Its IUPAC name is ethane;2-(1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinolin-3-yl)-2-oxoacetic acid.
| Compound Name | ethane;2-(1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinolin-3-yl)-2-oxoacetic acid |
|---|---|
| PubChem CID | 144699505 |
| Molecular Formula | C19H24FN3O4 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | ethane;2-(1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinolin-3-yl)-2-oxoacetic acid |
| SMILES | CC.CCn1cc(C(=O)C(=O)O)c(=O)c2cc(F)c(N3CCNCC3)cc21 |
| InChI | InChI=1S/C17H18FN3O4.C2H6/c1-2-20-9-11(16(23)17(24)25)15(22)10-7-12(18)14(8-13(10)20)21-5-3-19-4-6-21;1-2/h7-9,19H,2-6H2,1H3,(H,24,25);1-2H3 |
| InChIKey | WCXICOJSEDSTKH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|