C20H25FN4O2 — CID 167777571
N-(cyclopropylmethyl)-1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxamide (PubChem CID 167777571) has the molecular formula C20H25FN4O2 and a molecular weight of 372.44 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxamide.
| Compound Name | N-(cyclopropylmethyl)-1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 167777571 |
| Molecular Formula | C20H25FN4O2 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-(cyclopropylmethyl)-1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxamide |
| SMILES | CCn1cc(C(=O)NCC2CC2)c(=O)c2cc(F)c(N3CCNCC3)cc21 |
| InChI | InChI=1S/C20H25FN4O2/c1-2-24-12-15(20(27)23-11-13-3-4-13)19(26)14-9-16(21)18(10-17(14)24)25-7-5-22-6-8-25/h9-10,12-13,22H,2-8,11H2,1H3,(H,23,27) |
| InChIKey | SMWDVPRBPNHXLT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |