C18H23FN4O3 — CID 10959389
1-ethyl-6-fluoro-N-(2-hydroxyethyl)-4-oxo-7-piperazin-1-ylquinoline-3-carboxamide (PubChem CID 10959389) has the molecular formula C18H23FN4O3 and a molecular weight of 362.41 g/mol. Its IUPAC name is 1-ethyl-6-fluoro-N-(2-hydroxyethyl)-4-oxo-7-piperazin-1-ylquinoline-3-carboxamide.
| Compound Name | 1-ethyl-6-fluoro-N-(2-hydroxyethyl)-4-oxo-7-piperazin-1-ylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 10959389 |
| Molecular Formula | C18H23FN4O3 |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 1-ethyl-6-fluoro-N-(2-hydroxyethyl)-4-oxo-7-piperazin-1-ylquinoline-3-carboxamide |
| SMILES | CCn1cc(C(=O)NCCO)c(=O)c2cc(F)c(N3CCNCC3)cc21 |
| InChI | InChI=1S/C18H23FN4O3/c1-2-22-11-13(18(26)21-5-8-24)17(25)12-9-14(19)16(10-15(12)22)23-6-3-20-4-7-23/h9-11,20,24H,2-8H2,1H3,(H,21,26) |
| InChIKey | DEJSDJIERGNDFY-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |