C20H27N5O3 — CID 15797326
1-ethyl-4-oxo-6,7-di(piperazin-1-yl)quinoline-3-carboxylic acid (PubChem CID 15797326) has the molecular formula C20H27N5O3 and a molecular weight of 385.47 g/mol. Its IUPAC name is 1-ethyl-4-oxo-6,7-di(piperazin-1-yl)quinoline-3-carboxylic acid.
| Compound Name | 1-ethyl-4-oxo-6,7-di(piperazin-1-yl)quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 15797326 |
| Molecular Formula | C20H27N5O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 1-ethyl-4-oxo-6,7-di(piperazin-1-yl)quinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(N3CCNCC3)c(N3CCNCC3)cc21 |
| InChI | InChI=1S/C20H27N5O3/c1-2-23-13-15(20(27)28)19(26)14-11-17(24-7-3-21-4-8-24)18(12-16(14)23)25-9-5-22-6-10-25/h11-13,21-22H,2-10H2,1H3,(H,27,28) |
| InChIKey | NEULWVYSUPNEKQ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |