C17H19ClN2O3 — CID 12944899
6-chloro-1-ethyl-4-oxo-7-piperidin-1-ylquinoline-3-carboxylic acid (PubChem CID 12944899) has the molecular formula C17H19ClN2O3 and a molecular weight of 334.80 g/mol. Its IUPAC name is 6-chloro-1-ethyl-4-oxo-7-piperidin-1-ylquinoline-3-carboxylic acid.
| Compound Name | 6-chloro-1-ethyl-4-oxo-7-piperidin-1-ylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 12944899 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 6-chloro-1-ethyl-4-oxo-7-piperidin-1-ylquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(Cl)c(N3CCCCC3)cc21 |
| InChI | InChI=1S/C17H19ClN2O3/c1-2-19-10-12(17(22)23)16(21)11-8-13(18)15(9-14(11)19)20-6-4-3-5-7-20/h8-10H,2-7H2,1H3,(H,22,23) |
| InChIKey | VNUQHXQZYKGCMQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |