C16H18IN3O3 — CID 102122995
1-ethyl-6-iodo-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid (PubChem CID 102122995) has the molecular formula C16H18IN3O3 and a molecular weight of 427.24 g/mol. Its IUPAC name is 1-ethyl-6-iodo-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid.
| Compound Name | 1-ethyl-6-iodo-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 102122995 |
| Molecular Formula | C16H18IN3O3 |
| Molecular Weight | 427.24 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | 1-ethyl-6-iodo-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(I)c(N3CCNCC3)cc21 |
| InChI | InChI=1S/C16H18IN3O3/c1-2-19-9-11(16(22)23)15(21)10-7-12(17)14(8-13(10)19)20-5-3-18-4-6-20/h7-9,18H,2-6H2,1H3,(H,22,23) |
| InChIKey | DBHULNFLHVZJET-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|