C12H9FINO3 — CID 68795840
1-ethyl-7-fluoro-6-iodo-4-oxoquinoline-3-carboxylic acid (PubChem CID 68795840) has the molecular formula C12H9FINO3 and a molecular weight of 361.11 g/mol. Its IUPAC name is 1-ethyl-7-fluoro-6-iodo-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-ethyl-7-fluoro-6-iodo-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 68795840 |
| Molecular Formula | C12H9FINO3 |
| Molecular Weight | 361.11 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | 1-ethyl-7-fluoro-6-iodo-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(I)c(F)cc21 |
| InChI | InChI=1S/C12H9FINO3/c1-2-15-5-7(12(17)18)11(16)6-3-9(14)8(13)4-10(6)15/h3-5H,2H2,1H3,(H,17,18) |
| InChIKey | HPIDBHNBZRAKQX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.11 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|