C17H18FIN2O3 — CID 59617632
1-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-7-fluoro-6-iodo-4-oxoquinoline-3-carboxylic acid (PubChem CID 59617632) has the molecular formula C17H18FIN2O3 and a molecular weight of 444.24 g/mol. Its IUPAC name is 1-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-7-fluoro-6-iodo-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-7-fluoro-6-iodo-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 59617632 |
| Molecular Formula | C17H18FIN2O3 |
| Molecular Weight | 444.24 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | 1-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-7-fluoro-6-iodo-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCN1CCC[C@@H]1Cn1cc(C(=O)O)c(=O)c2cc(I)c(F)cc21 |
| InChI | InChI=1S/C17H18FIN2O3/c1-2-20-5-3-4-10(20)8-21-9-12(17(23)24)16(22)11-6-14(19)13(18)7-15(11)21/h6-7,9-10H,2-5,8H2,1H3,(H,23,24)/t10-/m1/s1 |
| InChIKey | PQDSXKPDXZUVBG-SNVBAGLBSA-N |
| XLogP | 2.93 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|