About di(propanoyloxy)boranyl 7-chloro-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate
di(propanoyloxy)boranyl 7-chloro-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate (PubChem CID 10938820) has the molecular formula C18H18BClFNO7
and a molecular weight of 425.61 g/mol. Its IUPAC name is di(propanoyloxy)boranyl 7-chloro-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate.
Molecular Properties
| Compound Name | di(propanoyloxy)boranyl 7-chloro-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate |
| PubChem CID | 10938820 |
| Molecular Formula | C18H18BClFNO7 |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | di(propanoyloxy)boranyl 7-chloro-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate |
| SMILES | CCC(=O)OB(OC(=O)CC)OC(=O)c1cn(CC)c2cc(Cl)c(F)cc2c1=O |
| InChI | InChI=1S/C18H18BClFNO7/c1-4-15(23)27-19(28-16(24)5-2)29-18(26)11-9-22(6-3)14-8-12(20)13(21)7-10(14)17(11)25/h7-9H,4-6H2,1-3H3 |
| InChIKey | HGUDMYKXRUJBOF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze di(propanoyloxy)boranyl 7-chloro-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(propanoyloxy)boranyl 7-chloro-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate?
The IUPAC name of di(propanoyloxy)boranyl 7-chloro-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate (CID 10938820) is di(propanoyloxy)boranyl 7-chloro-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate.
What is the SMILES notation for di(propanoyloxy)boranyl 7-chloro-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate?
The canonical SMILES for di(propanoyloxy)boranyl 7-chloro-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate is CCC(=O)OB(OC(=O)CC)OC(=O)c1cn(CC)c2cc(Cl)c(F)cc2c1=O.
What is the InChIKey of di(propanoyloxy)boranyl 7-chloro-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate?
The InChIKey is HGUDMYKXRUJBOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18BClFNO7/c1-4-15(23)27-19(28-16(24)5-2)29-18(26)11-9-22(6-3)14-8-12(20)13(21)7-10(14)17(11)25/h7-9H,4-6H2,1-3H3.
What are the key properties of di(propanoyloxy)boranyl 7-chloro-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate?
di(propanoyloxy)boranyl 7-chloro-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate has a molecular weight of 425.61 g/mol, XLogP of 2.86, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for di(propanoyloxy)boranyl 7-chloro-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate is sourced from PubChem (CID 10938820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).