C17H19ClFN3O6 — CID 10873416
7-chloro-1-ethyl-6-fluoro-4-oxo-N-[(E)-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentylidene]amino]quinoline-3-carboxamide (PubChem CID 10873416) has the molecular formula C17H19ClFN3O6 and a molecular weight of 415.81 g/mol. Its IUPAC name is 7-chloro-1-ethyl-6-fluoro-4-oxo-N-[(E)-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentylidene]amino]quinoline-3-carboxamide.
| Compound Name | 7-chloro-1-ethyl-6-fluoro-4-oxo-N-[(E)-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentylidene]amino]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 10873416 |
| Molecular Formula | C17H19ClFN3O6 |
| Molecular Weight | 415.81 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 7-chloro-1-ethyl-6-fluoro-4-oxo-N-[(E)-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentylidene]amino]quinoline-3-carboxamide |
| SMILES | CCn1cc(C(=O)N/N=C/[C@H](O)[C@H](O)[C@H](O)CO)c(=O)c2cc(F)c(Cl)cc21 |
| InChI | InChI=1S/C17H19ClFN3O6/c1-2-22-6-9(15(26)8-3-11(19)10(18)4-12(8)22)17(28)21-20-5-13(24)16(27)14(25)7-23/h3-6,13-14,16,23-25,27H,2,7H2,1H3,(H,21,28)/b20-5+/t13-,14+,16-/m0/s1 |
| InChIKey | XQURUNNQRFFBFC-ANAUWPBMSA-N |
| XLogP | -0.40 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.81 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|