C26H22FN5O4 — CID 135722709
1-ethyl-6-fluoro-N-[(E)-(4-hydroxyphenyl)methylideneamino]-7-[(2E)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-4-oxoquinoline-3-carboxamide (PubChem CID 135722709) has the molecular formula C26H22FN5O4 and a molecular weight of 487.49 g/mol. Its IUPAC name is 1-ethyl-6-fluoro-N-[(E)-(4-hydroxyphenyl)methylideneamino]-7-[(2E)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-4-oxoquinoline-3-carboxamide.
| Compound Name | 1-ethyl-6-fluoro-N-[(E)-(4-hydroxyphenyl)methylideneamino]-7-[(2E)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 135722709 |
| Molecular Formula | C26H22FN5O4 |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 1-ethyl-6-fluoro-N-[(E)-(4-hydroxyphenyl)methylideneamino]-7-[(2E)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-4-oxoquinoline-3-carboxamide |
| SMILES | CCn1cc(C(=O)N/N=C/c2ccc(O)cc2)c(=O)c2cc(F)c(N/N=C/c3ccc(O)cc3)cc21 |
| InChI | InChI=1S/C26H22FN5O4/c1-2-32-15-21(26(36)31-29-14-17-5-9-19(34)10-6-17)25(35)20-11-22(27)23(12-24(20)32)30-28-13-16-3-7-18(33)8-4-16/h3-15,30,33-34H,2H2,1H3,(H,31,36)/b28-13+,29-14+ |
| InChIKey | NTKABZMUKATFJP-JOFLXYQRSA-N |
| XLogP | 3.78 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|