C24H18F2N4O4 — CID 71548630
1-(4-amino-2-fluorophenyl)-6-fluoro-7-[(2E)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 71548630) has the molecular formula C24H18F2N4O4 and a molecular weight of 464.43 g/mol. Its IUPAC name is 1-(4-amino-2-fluorophenyl)-6-fluoro-7-[(2E)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-(4-amino-2-fluorophenyl)-6-fluoro-7-[(2E)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 71548630 |
| Molecular Formula | C24H18F2N4O4 |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 1-(4-amino-2-fluorophenyl)-6-fluoro-7-[(2E)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | COc1ccc(/C=N/Nc2cc3c(cc2F)c(=O)c(C(=O)O)cn3-c2ccc(N)cc2F)cc1 |
| InChI | InChI=1S/C24H18F2N4O4/c1-34-15-5-2-13(3-6-15)11-28-29-20-10-22-16(9-18(20)25)23(31)17(24(32)33)12-30(22)21-7-4-14(27)8-19(21)26/h2-12,29H,27H2,1H3,(H,32,33)/b28-11+ |
| InChIKey | JALXVQANAVFRSL-IPBVOBEMSA-N |
| XLogP | 4.00 |
| TPSA | 118.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|