C24H18F2N4O4 — CID 123575381
1-(4-amino-2-fluorophenyl)-6-fluoro-7-[[4-(hydroxymethyl)phenyl]methyldiazenyl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 123575381) has the molecular formula C24H18F2N4O4 and a molecular weight of 464.43 g/mol. Its IUPAC name is 1-(4-amino-2-fluorophenyl)-6-fluoro-7-[[4-(hydroxymethyl)phenyl]methyldiazenyl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-(4-amino-2-fluorophenyl)-6-fluoro-7-[[4-(hydroxymethyl)phenyl]methyldiazenyl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 123575381 |
| Molecular Formula | C24H18F2N4O4 |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 1-(4-amino-2-fluorophenyl)-6-fluoro-7-[[4-(hydroxymethyl)phenyl]methyldiazenyl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | Nc1ccc(-n2cc(C(=O)O)c(=O)c3cc(F)c(/N=N/Cc4ccc(CO)cc4)cc32)c(F)c1 |
| InChI | InChI=1S/C24H18F2N4O4/c25-18-8-16-22(9-20(18)29-28-10-13-1-3-14(12-31)4-2-13)30(11-17(23(16)32)24(33)34)21-6-5-15(27)7-19(21)26/h1-9,11,31H,10,12,27H2,(H,33,34)/b29-28+ |
| InChIKey | SKSSSEFPYLMMFD-ZQHSETAFSA-N |
| XLogP | 4.33 |
| TPSA | 130.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|