C21H17F2N3O5 — CID 5270922
6-fluoro-1-(2-fluoro-4-nitrophenyl)-4-oxo-7-piperidin-1-ylquinoline-3-carboxylic acid (PubChem CID 5270922) has the molecular formula C21H17F2N3O5 and a molecular weight of 429.38 g/mol. Its IUPAC name is 6-fluoro-1-(2-fluoro-4-nitrophenyl)-4-oxo-7-piperidin-1-ylquinoline-3-carboxylic acid.
| Compound Name | 6-fluoro-1-(2-fluoro-4-nitrophenyl)-4-oxo-7-piperidin-1-ylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 5270922 |
| Molecular Formula | C21H17F2N3O5 |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 6-fluoro-1-(2-fluoro-4-nitrophenyl)-4-oxo-7-piperidin-1-ylquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(-c2ccc([N+](=O)[O-])cc2F)c2cc(N3CCCCC3)c(F)cc2c1=O |
| InChI | InChI=1S/C21H17F2N3O5/c22-15-8-12(26(30)31)4-5-17(15)25-11-14(21(28)29)20(27)13-9-16(23)19(10-18(13)25)24-6-2-1-3-7-24/h4-5,8-11H,1-3,6-7H2,(H,28,29) |
| InChIKey | JLFRJECAQOOXMX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|