C21H18FN3O5 — CID 23878924
1-(4-carboxyphenyl)-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid (PubChem CID 23878924) has the molecular formula C21H18FN3O5 and a molecular weight of 411.39 g/mol. Its IUPAC name is 1-(4-carboxyphenyl)-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid.
| Compound Name | 1-(4-carboxyphenyl)-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 23878924 |
| Molecular Formula | C21H18FN3O5 |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 1-(4-carboxyphenyl)-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(-n2cc(C(=O)O)c(=O)c3cc(F)c(N4CCNCC4)cc32)cc1 |
| InChI | InChI=1S/C21H18FN3O5/c22-16-9-14-17(10-18(16)24-7-5-23-6-8-24)25(11-15(19(14)26)21(29)30)13-3-1-12(2-4-13)20(27)28/h1-4,9-11,23H,5-8H2,(H,27,28)(H,29,30) |
| InChIKey | VYFIJNFIYJWILB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |