C21H22FN3O7 — CID 46190704
(Z)-but-2-enedioic acid;1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid (PubChem CID 46190704) has the molecular formula C21H22FN3O7 and a molecular weight of 447.42 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid.
| Compound Name | (Z)-but-2-enedioic acid;1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 46190704 |
| Molecular Formula | C21H22FN3O7 |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid |
| SMILES | O=C(O)/C=C\C(=O)O.O=C(O)c1cn(C2CC2)c2cc(N3CCNCC3)c(F)cc2c1=O |
| InChI | InChI=1S/C17H18FN3O3.C4H4O4/c18-13-7-11-14(8-15(13)20-5-3-19-4-6-20)21(10-1-2-10)9-12(16(11)22)17(23)24;5-3(6)1-2-4(7)8/h7-10,19H,1-6H2,(H,23,24);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | LXDVYYPQSYALQG-BTJKTKAUSA-N |
| XLogP | 1.30 |
| TPSA | 149.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|