C21H20FN3O7 — CID 54159411
2-[4-(3-carboxy-1-cyclopropyl-6-fluoro-4-oxoquinolin-7-yl)piperazin-1-yl]but-2-enedioic acid (PubChem CID 54159411) has the molecular formula C21H20FN3O7 and a molecular weight of 445.40 g/mol. Its IUPAC name is 2-[4-(3-carboxy-1-cyclopropyl-6-fluoro-4-oxoquinolin-7-yl)piperazin-1-yl]but-2-enedioic acid.
| Compound Name | 2-[4-(3-carboxy-1-cyclopropyl-6-fluoro-4-oxoquinolin-7-yl)piperazin-1-yl]but-2-enedioic acid |
|---|---|
| PubChem CID | 54159411 |
| Molecular Formula | C21H20FN3O7 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 2-[4-(3-carboxy-1-cyclopropyl-6-fluoro-4-oxoquinolin-7-yl)piperazin-1-yl]but-2-enedioic acid |
| SMILES | O=C(O)C=C(C(=O)O)N1CCN(c2cc3c(cc2F)c(=O)c(C(=O)O)cn3C2CC2)CC1 |
| InChI | InChI=1S/C21H20FN3O7/c22-14-7-12-15(25(11-1-2-11)10-13(19(12)28)20(29)30)8-16(14)23-3-5-24(6-4-23)17(21(31)32)9-18(26)27/h7-11H,1-6H2,(H,26,27)(H,29,30)(H,31,32) |
| InChIKey | ONJHMXMJKSCWRU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 140.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|