C17H17FIN3O3 — CID 129154415
1-cyclopropyl-6-fluoro-7-(4-iodopiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid (PubChem CID 129154415) has the molecular formula C17H17FIN3O3 and a molecular weight of 457.24 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-7-(4-iodopiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-6-fluoro-7-(4-iodopiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 129154415 |
| Molecular Formula | C17H17FIN3O3 |
| Molecular Weight | 457.24 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-7-(4-iodopiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(C2CC2)c2cc(N3CCN(I)CC3)c(F)cc2c1=O |
| InChI | InChI=1S/C17H17FIN3O3/c18-13-7-11-14(8-15(13)20-3-5-21(19)6-4-20)22(10-1-2-10)9-12(16(11)23)17(24)25/h7-10H,1-6H2,(H,24,25) |
| InChIKey | NBXXKJCUFZPIIF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|