C17H17FN2O3S — CID 18631753
1-cyclopropyl-6-fluoro-4-oxo-7-[(3R)-3-sulfanylpyrrolidin-1-yl]quinoline-3-carboxylic acid (PubChem CID 18631753) has the molecular formula C17H17FN2O3S and a molecular weight of 348.40 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-4-oxo-7-[(3R)-3-sulfanylpyrrolidin-1-yl]quinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-6-fluoro-4-oxo-7-[(3R)-3-sulfanylpyrrolidin-1-yl]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 18631753 |
| Molecular Formula | C17H17FN2O3S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-4-oxo-7-[(3R)-3-sulfanylpyrrolidin-1-yl]quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(C2CC2)c2cc(N3CC[C@@H](S)C3)c(F)cc2c1=O |
| InChI | InChI=1S/C17H17FN2O3S/c18-13-5-11-14(6-15(13)19-4-3-10(24)7-19)20(9-1-2-9)8-12(16(11)21)17(22)23/h5-6,8-10,24H,1-4,7H2,(H,22,23)/t10-/m1/s1 |
| InChIKey | XISCDIVVDYIYNP-SNVBAGLBSA-N |
| XLogP | 2.68 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|