C25H24FN3O3 — CID 175129641
1-cyclopropyl-6-fluoro-3-[3-(4-hydroxyphenyl)prop-2-enoyl]-7-piperazin-1-ylquinolin-4-one (PubChem CID 175129641) has the molecular formula C25H24FN3O3 and a molecular weight of 433.48 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-3-[3-(4-hydroxyphenyl)prop-2-enoyl]-7-piperazin-1-ylquinolin-4-one.
| Compound Name | 1-cyclopropyl-6-fluoro-3-[3-(4-hydroxyphenyl)prop-2-enoyl]-7-piperazin-1-ylquinolin-4-one |
|---|---|
| PubChem CID | 175129641 |
| Molecular Formula | C25H24FN3O3 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-3-[3-(4-hydroxyphenyl)prop-2-enoyl]-7-piperazin-1-ylquinolin-4-one |
| SMILES | O=C(C=Cc1ccc(O)cc1)c1cn(C2CC2)c2cc(N3CCNCC3)c(F)cc2c1=O |
| InChI | InChI=1S/C25H24FN3O3/c26-21-13-19-22(14-23(21)28-11-9-27-10-12-28)29(17-4-5-17)15-20(25(19)32)24(31)8-3-16-1-6-18(30)7-2-16/h1-3,6-8,13-15,17,27,30H,4-5,9-12H2 |
| InChIKey | UTKYXYCOFXWJLK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|