C27H27BrFN3O2 — CID 175030306
3-[(E)-3-(4-bromophenyl)prop-2-enoyl]-1-cyclopropyl-7-(4-ethylpiperazin-1-yl)-6-fluoroquinolin-4-one (PubChem CID 175030306) has the molecular formula C27H27BrFN3O2 and a molecular weight of 524.43 g/mol. Its IUPAC name is 3-[(E)-3-(4-bromophenyl)prop-2-enoyl]-1-cyclopropyl-7-(4-ethylpiperazin-1-yl)-6-fluoroquinolin-4-one.
| Compound Name | 3-[(E)-3-(4-bromophenyl)prop-2-enoyl]-1-cyclopropyl-7-(4-ethylpiperazin-1-yl)-6-fluoroquinolin-4-one |
|---|---|
| PubChem CID | 175030306 |
| Molecular Formula | C27H27BrFN3O2 |
| Molecular Weight | 524.43 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | 3-[(E)-3-(4-bromophenyl)prop-2-enoyl]-1-cyclopropyl-7-(4-ethylpiperazin-1-yl)-6-fluoroquinolin-4-one |
| SMILES | CCN1CCN(c2cc3c(cc2F)c(=O)c(C(=O)/C=C/c2ccc(Br)cc2)cn3C2CC2)CC1 |
| InChI | InChI=1S/C27H27BrFN3O2/c1-2-30-11-13-31(14-12-30)25-16-24-21(15-23(25)29)27(34)22(17-32(24)20-8-9-20)26(33)10-5-18-3-6-19(28)7-4-18/h3-7,10,15-17,20H,2,8-9,11-14H2,1H3/b10-5+ |
| InChIKey | FFBNFKDTFAJDSM-BJMVGYQFSA-N |
| XLogP | 5.28 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.43 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|