C21H27FN4O3 — CID 176957523
1-cyclopropyl-7-(4-ethylpiperazin-1-yl)-6-fluoro-N-methoxy-N-methyl-4-oxoquinoline-3-carboxamide (PubChem CID 176957523) has the molecular formula C21H27FN4O3 and a molecular weight of 402.47 g/mol. Its IUPAC name is 1-cyclopropyl-7-(4-ethylpiperazin-1-yl)-6-fluoro-N-methoxy-N-methyl-4-oxoquinoline-3-carboxamide.
| Compound Name | 1-cyclopropyl-7-(4-ethylpiperazin-1-yl)-6-fluoro-N-methoxy-N-methyl-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 176957523 |
| Molecular Formula | C21H27FN4O3 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 1-cyclopropyl-7-(4-ethylpiperazin-1-yl)-6-fluoro-N-methoxy-N-methyl-4-oxoquinoline-3-carboxamide |
| SMILES | CCN1CCN(c2cc3c(cc2F)c(=O)c(C(=O)N(C)OC)cn3C2CC2)CC1 |
| InChI | InChI=1S/C21H27FN4O3/c1-4-24-7-9-25(10-8-24)19-12-18-15(11-17(19)22)20(27)16(21(28)23(2)29-3)13-26(18)14-5-6-14/h11-14H,4-10H2,1-3H3 |
| InChIKey | NTWVPHIFQVEHPU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 58.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|