C26H25F2N3O3 — CID 175127626
7-(4-acetylpiperazin-1-yl)-1-ethyl-6-fluoro-3-[3-(4-fluorophenyl)prop-2-enoyl]quinolin-4-one (PubChem CID 175127626) has the molecular formula C26H25F2N3O3 and a molecular weight of 465.50 g/mol. Its IUPAC name is 7-(4-acetylpiperazin-1-yl)-1-ethyl-6-fluoro-3-[3-(4-fluorophenyl)prop-2-enoyl]quinolin-4-one.
| Compound Name | 7-(4-acetylpiperazin-1-yl)-1-ethyl-6-fluoro-3-[3-(4-fluorophenyl)prop-2-enoyl]quinolin-4-one |
|---|---|
| PubChem CID | 175127626 |
| Molecular Formula | C26H25F2N3O3 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 7-(4-acetylpiperazin-1-yl)-1-ethyl-6-fluoro-3-[3-(4-fluorophenyl)prop-2-enoyl]quinolin-4-one |
| SMILES | CCn1cc(C(=O)C=Cc2ccc(F)cc2)c(=O)c2cc(F)c(N3CCN(C(C)=O)CC3)cc21 |
| InChI | InChI=1S/C26H25F2N3O3/c1-3-29-16-21(25(33)9-6-18-4-7-19(27)8-5-18)26(34)20-14-22(28)24(15-23(20)29)31-12-10-30(11-13-31)17(2)32/h4-9,14-16H,3,10-13H2,1-2H3 |
| InChIKey | RJUCLSXKEBGOLV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|