C26H25FN4O3 — CID 175202206
7-(4-acetylpiperazin-1-yl)-1-cyclopropyl-6-fluoro-3-(3-pyridin-3-ylprop-2-enoyl)quinolin-4-one (PubChem CID 175202206) has the molecular formula C26H25FN4O3 and a molecular weight of 460.51 g/mol. Its IUPAC name is 7-(4-acetylpiperazin-1-yl)-1-cyclopropyl-6-fluoro-3-(3-pyridin-3-ylprop-2-enoyl)quinolin-4-one.
| Compound Name | 7-(4-acetylpiperazin-1-yl)-1-cyclopropyl-6-fluoro-3-(3-pyridin-3-ylprop-2-enoyl)quinolin-4-one |
|---|---|
| PubChem CID | 175202206 |
| Molecular Formula | C26H25FN4O3 |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 7-(4-acetylpiperazin-1-yl)-1-cyclopropyl-6-fluoro-3-(3-pyridin-3-ylprop-2-enoyl)quinolin-4-one |
| SMILES | CC(=O)N1CCN(c2cc3c(cc2F)c(=O)c(C(=O)C=Cc2cccnc2)cn3C2CC2)CC1 |
| InChI | InChI=1S/C26H25FN4O3/c1-17(32)29-9-11-30(12-10-29)24-14-23-20(13-22(24)27)26(34)21(16-31(23)19-5-6-19)25(33)7-4-18-3-2-8-28-15-18/h2-4,7-8,13-16,19H,5-6,9-12H2,1H3 |
| InChIKey | KJRSVASBXIMFRB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|